| Name | Alpha,Alpha-Dibromotoluene |
| Synonyms | BENZAL BROMIDE Benzal bromide benzylene bromide α,α-dibromotoluene (dibromomethyl)benzene Alpha,Alpha-Dibromotoluene ALPHA,ALPHA-DIBROMOTOLUENE alpha, alpha-Dibromophenylmethane alpha,alpha-DibromotolueneBenzal bromide |
| CAS | 618-31-5 |
| EINECS | 210-543-7 |
| InChI | InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| Molecular Formula | C7H6Br2 |
| Molar Mass | 249.93 |
| Density | 1.881g/cm3 |
| Melting Point | 111℃ |
| Boling Point | 276.6°C at 760 mmHg |
| Flash Point | 100.2°C |
| Vapor Presure | 0.00802mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.619 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R23/24 - Toxic by inhalation and in contact with skin. R33 - Danger of cumulative effects |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN 2927 6.1/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 19 |
| Hazard Class | 6.1(a) |
| Packing Group | II |
| BRN | 1906098 |